C38H40O9 — CID 10875969
[(1S,2S,5S,8R,10R)-10-acetyloxy-1-hydroxy-8,12,15,15-tetramethyl-4-methylidene-9,13-dioxo-5-[(E)-3-phenylprop-2-enoyl]oxy-2-tricyclo[9.3.1.03,8]pentadec-11-enyl] benzoate (PubChem CID 10875969) has the molecular formula C38H40O9 and a molecular weight of 640.73 g/mol. Its IUPAC name is [(1S,2S,5S,8R,10R)-10-acetyloxy-1-hydroxy-8,12,15,15-tetramethyl-4-methylidene-9,13-dioxo-5-[(E)-3-phenylprop-2-enoyl]oxy-2-tricyclo[9.3.1.03,8]pentadec-11-enyl] benzoate.
| Compound Name | [(1S,2S,5S,8R,10R)-10-acetyloxy-1-hydroxy-8,12,15,15-tetramethyl-4-methylidene-9,13-dioxo-5-[(E)-3-phenylprop-2-enoyl]oxy-2-tricyclo[9.3.1.03,8]pentadec-11-enyl] benzoate |
|---|---|
| PubChem CID | 10875969 |
| Molecular Formula | C38H40O9 |
| Molecular Weight | 640.73 g/mol |
| Exact Mass | 640.27 |
| IUPAC Name | [(1S,2S,5S,8R,10R)-10-acetyloxy-1-hydroxy-8,12,15,15-tetramethyl-4-methylidene-9,13-dioxo-5-[(E)-3-phenylprop-2-enoyl]oxy-2-tricyclo[9.3.1.03,8]pentadec-11-enyl] benzoate |
| SMILES | C=C1C2[C@H](OC(=O)c3ccccc3)[C@]3(O)CC(=O)C(C)=C([C@@H](OC(C)=O)C(=O)[C@]2(C)CC[C@@H]1OC(=O)/C=C/c1ccccc1)C3(C)C |
| InChI | InChI=1S/C38H40O9/c1-22-27(40)21-38(44)34(47-35(43)26-15-11-8-12-16-26)31-23(2)28(46-29(41)18-17-25-13-9-7-10-14-25)19-20-37(31,6)33(42)32(45-24(3)39)30(22)36(38,4)5/h7-18,28,31-32,34,44H,2,19-21H2,1,3-6H3/b18-17+/t28-,31?,32+,34-,37+,38+/m0/s1 |
| InChIKey | UTMATWCNXAZOHH-JFPMTGRRSA-N |
| XLogP | 5.37 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.73 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|