C38H40O8 — CID 162912355
(13-acetyloxy-11,15,18,18-tetramethyl-7-methylidene-12,16-dioxo-3-phenyl-2,4-dioxatetracyclo[12.3.1.01,5.06,11]octadec-14-en-8-yl) 3-phenylprop-2-enoate (PubChem CID 162912355) has the molecular formula C38H40O8 and a molecular weight of 624.73 g/mol. Its IUPAC name is (13-acetyloxy-11,15,18,18-tetramethyl-7-methylidene-12,16-dioxo-3-phenyl-2,4-dioxatetracyclo[12.3.1.01,5.06,11]octadec-14-en-8-yl) 3-phenylprop-2-enoate.
| Compound Name | (13-acetyloxy-11,15,18,18-tetramethyl-7-methylidene-12,16-dioxo-3-phenyl-2,4-dioxatetracyclo[12.3.1.01,5.06,11]octadec-14-en-8-yl) 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 162912355 |
| Molecular Formula | C38H40O8 |
| Molecular Weight | 624.73 g/mol |
| Exact Mass | 624.27 |
| IUPAC Name | (13-acetyloxy-11,15,18,18-tetramethyl-7-methylidene-12,16-dioxo-3-phenyl-2,4-dioxatetracyclo[12.3.1.01,5.06,11]octadec-14-en-8-yl) 3-phenylprop-2-enoate |
| SMILES | C=C1C(OC(=O)C=Cc2ccccc2)CCC2(C)C(=O)C(OC(C)=O)C3=C(C)C(=O)CC4(OC(c5ccccc5)OC4C12)C3(C)C |
| InChI | InChI=1S/C38H40O8/c1-22-27(40)21-38-34(45-35(46-38)26-15-11-8-12-16-26)31-23(2)28(44-29(41)18-17-25-13-9-7-10-14-25)19-20-37(31,6)33(42)32(43-24(3)39)30(22)36(38,4)5/h7-18,28,31-32,34-35H,2,19-21H2,1,3-6H3 |
| InChIKey | JOBXTDRMHMODRA-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.73 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|