C17H19N5OS — CID 44569128
6-amino-1-methyl-7-[4-(1,3-thiazol-2-yl)piperazin-1-yl]quinolin-4-one (PubChem CID 44569128) has the molecular formula C17H19N5OS and a molecular weight of 341.44 g/mol. Its IUPAC name is 6-amino-1-methyl-7-[4-(1,3-thiazol-2-yl)piperazin-1-yl]quinolin-4-one.
| Compound Name | 6-amino-1-methyl-7-[4-(1,3-thiazol-2-yl)piperazin-1-yl]quinolin-4-one |
|---|---|
| PubChem CID | 44569128 |
| Molecular Formula | C17H19N5OS |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 6-amino-1-methyl-7-[4-(1,3-thiazol-2-yl)piperazin-1-yl]quinolin-4-one |
| SMILES | Cn1ccc(=O)c2cc(N)c(N3CCN(c4nccs4)CC3)cc21 |
| InChI | InChI=1S/C17H19N5OS/c1-20-4-2-16(23)12-10-13(18)15(11-14(12)20)21-5-7-22(8-6-21)17-19-3-9-24-17/h2-4,9-11H,5-8,18H2,1H3 |
| InChIKey | KOWYIWUOEWEABR-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 67.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|