C18H19N5O3S — CID 3012839
6-amino-1-methyl-4-oxo-7-[4-(1,3-thiazol-2-yl)piperazin-1-yl]quinoline-3-carboxylic acid (PubChem CID 3012839) has the molecular formula C18H19N5O3S and a molecular weight of 385.45 g/mol. Its IUPAC name is 6-amino-1-methyl-4-oxo-7-[4-(1,3-thiazol-2-yl)piperazin-1-yl]quinoline-3-carboxylic acid.
| Compound Name | 6-amino-1-methyl-4-oxo-7-[4-(1,3-thiazol-2-yl)piperazin-1-yl]quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 3012839 |
| Molecular Formula | C18H19N5O3S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 6-amino-1-methyl-4-oxo-7-[4-(1,3-thiazol-2-yl)piperazin-1-yl]quinoline-3-carboxylic acid |
| SMILES | Cn1cc(C(=O)O)c(=O)c2cc(N)c(N3CCN(c4nccs4)CC3)cc21 |
| InChI | InChI=1S/C18H19N5O3S/c1-21-10-12(17(25)26)16(24)11-8-13(19)15(9-14(11)21)22-3-5-23(6-4-22)18-20-2-7-27-18/h2,7-10H,3-6,19H2,1H3,(H,25,26) |
| InChIKey | SAYURQWZBRJBJZ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 104.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|