C17H17N5O3S — CID 25053732
6-amino-4-oxo-7-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-1H-quinoline-3-carboxylic acid (PubChem CID 25053732) has the molecular formula C17H17N5O3S and a molecular weight of 371.42 g/mol. Its IUPAC name is 6-amino-4-oxo-7-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-1H-quinoline-3-carboxylic acid.
| Compound Name | 6-amino-4-oxo-7-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-1H-quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 25053732 |
| Molecular Formula | C17H17N5O3S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 6-amino-4-oxo-7-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-1H-quinoline-3-carboxylic acid |
| SMILES | Nc1cc2c(=O)c(C(=O)O)c[nH]c2cc1N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C17H17N5O3S/c18-12-7-10-13(20-9-11(15(10)23)16(24)25)8-14(12)21-2-4-22(5-3-21)17-19-1-6-26-17/h1,6-9H,2-5,18H2,(H,20,23)(H,24,25) |
| InChIKey | BCICSHUUOHILFV-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 115.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|