C26H33N9O8S2 — CID 44569382
[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-[(2S)-2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]sulfamate (PubChem CID 44569382) has the molecular formula C26H33N9O8S2 and a molecular weight of 663.74 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-[(2S)-2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]sulfamate.
| Compound Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-[(2S)-2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]sulfamate |
|---|---|
| PubChem CID | 44569382 |
| Molecular Formula | C26H33N9O8S2 |
| Molecular Weight | 663.74 g/mol |
| Exact Mass | 663.19 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-[(2S)-2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]sulfamate |
| SMILES | CSCC[C@H](N)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)NS(=O)(=O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C26H33N9O8S2/c1-44-7-6-15(27)24(38)33-17(8-13-9-29-16-5-3-2-4-14(13)16)25(39)34-45(40,41)42-10-18-20(36)21(37)26(43-18)35-12-32-19-22(28)30-11-31-23(19)35/h2-5,9,11-12,15,17-18,20-21,26,29,36-37H,6-8,10,27H2,1H3,(H,33,38)(H,34,39)(H2,28,30,31)/t15-,17-,18+,20+,21+,26+/m0/s1 |
| InChIKey | NEPFEZHBKWUMQE-YBGCKTMSSA-N |
| XLogP | -1.31 |
| TPSA | 262.69 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.74 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 15 |