C21H26BrClN2O2S — CID 44570981
2-[4-[[3-(4-bromophenyl)-1,2-benzothiazol-6-yl]oxy]butyl-ethylamino]ethanol;hydrochloride (PubChem CID 44570981) has the molecular formula C21H26BrClN2O2S and a molecular weight of 485.88 g/mol. Its IUPAC name is 2-[4-[[3-(4-bromophenyl)-1,2-benzothiazol-6-yl]oxy]butyl-ethylamino]ethanol;hydrochloride.
| Compound Name | 2-[4-[[3-(4-bromophenyl)-1,2-benzothiazol-6-yl]oxy]butyl-ethylamino]ethanol;hydrochloride |
|---|---|
| PubChem CID | 44570981 |
| Molecular Formula | C21H26BrClN2O2S |
| Molecular Weight | 485.88 g/mol |
| Exact Mass | 484.06 |
| IUPAC Name | 2-[4-[[3-(4-bromophenyl)-1,2-benzothiazol-6-yl]oxy]butyl-ethylamino]ethanol;hydrochloride |
| SMILES | CCN(CCO)CCCCOc1ccc2c(-c3ccc(Br)cc3)nsc2c1.Cl |
| InChI | InChI=1S/C21H25BrN2O2S.ClH/c1-2-24(12-13-25)11-3-4-14-26-18-9-10-19-20(15-18)27-23-21(19)16-5-7-17(22)8-6-16;/h5-10,15,25H,2-4,11-14H2,1H3;1H |
| InChIKey | JXPRRQCJDYYJLX-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.88 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|