C22H25F3N2O2S — CID 10181629
2-[ethyl-[4-[[3-[4-(trifluoromethyl)phenyl]-1,2-benzothiazol-6-yl]oxy]butyl]amino]ethanol (PubChem CID 10181629) has the molecular formula C22H25F3N2O2S and a molecular weight of 438.52 g/mol. Its IUPAC name is 2-[ethyl-[4-[[3-[4-(trifluoromethyl)phenyl]-1,2-benzothiazol-6-yl]oxy]butyl]amino]ethanol.
| Compound Name | 2-[ethyl-[4-[[3-[4-(trifluoromethyl)phenyl]-1,2-benzothiazol-6-yl]oxy]butyl]amino]ethanol |
|---|---|
| PubChem CID | 10181629 |
| Molecular Formula | C22H25F3N2O2S |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 2-[ethyl-[4-[[3-[4-(trifluoromethyl)phenyl]-1,2-benzothiazol-6-yl]oxy]butyl]amino]ethanol |
| SMILES | CCN(CCO)CCCCOc1ccc2c(-c3ccc(C(F)(F)F)cc3)nsc2c1 |
| InChI | InChI=1S/C22H25F3N2O2S/c1-2-27(12-13-28)11-3-4-14-29-18-9-10-19-20(15-18)30-26-21(19)16-5-7-17(8-6-16)22(23,24)25/h5-10,15,28H,2-4,11-14H2,1H3 |
| InChIKey | UZVJQRKJSYUQPR-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|