C21H23BrN2O3S — CID 44571035
N-[4-[[3-(4-bromophenyl)-1,2-benzothiazol-6-yl]oxy]butyl]-N-(2-hydroxyethyl)acetamide (PubChem CID 44571035) has the molecular formula C21H23BrN2O3S and a molecular weight of 463.40 g/mol. Its IUPAC name is N-[4-[[3-(4-bromophenyl)-1,2-benzothiazol-6-yl]oxy]butyl]-N-(2-hydroxyethyl)acetamide.
| Compound Name | N-[4-[[3-(4-bromophenyl)-1,2-benzothiazol-6-yl]oxy]butyl]-N-(2-hydroxyethyl)acetamide |
|---|---|
| PubChem CID | 44571035 |
| Molecular Formula | C21H23BrN2O3S |
| Molecular Weight | 463.40 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | N-[4-[[3-(4-bromophenyl)-1,2-benzothiazol-6-yl]oxy]butyl]-N-(2-hydroxyethyl)acetamide |
| SMILES | CC(=O)N(CCO)CCCCOc1ccc2c(-c3ccc(Br)cc3)nsc2c1 |
| InChI | InChI=1S/C21H23BrN2O3S/c1-15(26)24(11-12-25)10-2-3-13-27-18-8-9-19-20(14-18)28-23-21(19)16-4-6-17(22)7-5-16/h4-9,14,25H,2-3,10-13H2,1H3 |
| InChIKey | SGLOCIXOQYYXBE-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.40 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|