C20H17Cl4N3O2 — CID 44571428
butyl 2-[4,5-bis(2,4-dichlorophenyl)triazol-1-yl]acetate (PubChem CID 44571428) has the molecular formula C20H17Cl4N3O2 and a molecular weight of 473.19 g/mol. Its IUPAC name is butyl 2-[4,5-bis(2,4-dichlorophenyl)triazol-1-yl]acetate.
| Compound Name | butyl 2-[4,5-bis(2,4-dichlorophenyl)triazol-1-yl]acetate |
|---|---|
| PubChem CID | 44571428 |
| Molecular Formula | C20H17Cl4N3O2 |
| Molecular Weight | 473.19 g/mol |
| Exact Mass | 471.01 |
| IUPAC Name | butyl 2-[4,5-bis(2,4-dichlorophenyl)triazol-1-yl]acetate |
| SMILES | CCCCOC(=O)Cn1nnc(-c2ccc(Cl)cc2Cl)c1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H17Cl4N3O2/c1-2-3-8-29-18(28)11-27-20(15-7-5-13(22)10-17(15)24)19(25-26-27)14-6-4-12(21)9-16(14)23/h4-7,9-10H,2-3,8,11H2,1H3 |
| InChIKey | UNWZYLLJZADZTJ-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.19 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|