C20H19Cl2N3O2 — CID 59363269
butyl 2-[4,5-bis(3-chlorophenyl)triazol-1-yl]acetate (PubChem CID 59363269) has the molecular formula C20H19Cl2N3O2 and a molecular weight of 404.30 g/mol. Its IUPAC name is butyl 2-[4,5-bis(3-chlorophenyl)triazol-1-yl]acetate.
| Compound Name | butyl 2-[4,5-bis(3-chlorophenyl)triazol-1-yl]acetate |
|---|---|
| PubChem CID | 59363269 |
| Molecular Formula | C20H19Cl2N3O2 |
| Molecular Weight | 404.30 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | butyl 2-[4,5-bis(3-chlorophenyl)triazol-1-yl]acetate |
| SMILES | CCCCOC(=O)Cn1nnc(-c2cccc(Cl)c2)c1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H19Cl2N3O2/c1-2-3-10-27-18(26)13-25-20(15-7-5-9-17(22)12-15)19(23-24-25)14-6-4-8-16(21)11-14/h4-9,11-12H,2-3,10,13H2,1H3 |
| InChIKey | KUZDSZDLJNDGSY-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.30 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|