C21H21Cl2N3O2 — CID 59363183
pentan-3-yl 2-[4,5-bis(4-chlorophenyl)triazol-1-yl]acetate (PubChem CID 59363183) has the molecular formula C21H21Cl2N3O2 and a molecular weight of 418.32 g/mol. Its IUPAC name is pentan-3-yl 2-[4,5-bis(4-chlorophenyl)triazol-1-yl]acetate.
| Compound Name | pentan-3-yl 2-[4,5-bis(4-chlorophenyl)triazol-1-yl]acetate |
|---|---|
| PubChem CID | 59363183 |
| Molecular Formula | C21H21Cl2N3O2 |
| Molecular Weight | 418.32 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | pentan-3-yl 2-[4,5-bis(4-chlorophenyl)triazol-1-yl]acetate |
| SMILES | CCC(CC)OC(=O)Cn1nnc(-c2ccc(Cl)cc2)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H21Cl2N3O2/c1-3-18(4-2)28-19(27)13-26-21(15-7-11-17(23)12-8-15)20(24-25-26)14-5-9-16(22)10-6-14/h5-12,18H,3-4,13H2,1-2H3 |
| InChIKey | VDHAJRHVHYDVOM-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.32 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |