C20H18N4O4S — CID 44571913
2-methyl-N-pyridin-3-yl-5-[(3-sulfamoylbenzoyl)amino]benzamide (PubChem CID 44571913) has the molecular formula C20H18N4O4S and a molecular weight of 410.46 g/mol. Its IUPAC name is 2-methyl-N-pyridin-3-yl-5-[(3-sulfamoylbenzoyl)amino]benzamide.
| Compound Name | 2-methyl-N-pyridin-3-yl-5-[(3-sulfamoylbenzoyl)amino]benzamide |
|---|---|
| PubChem CID | 44571913 |
| Molecular Formula | C20H18N4O4S |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 2-methyl-N-pyridin-3-yl-5-[(3-sulfamoylbenzoyl)amino]benzamide |
| SMILES | Cc1ccc(NC(=O)c2cccc(S(N)(=O)=O)c2)cc1C(=O)Nc1cccnc1 |
| InChI | InChI=1S/C20H18N4O4S/c1-13-7-8-15(11-18(13)20(26)24-16-5-3-9-22-12-16)23-19(25)14-4-2-6-17(10-14)29(21,27)28/h2-12H,1H3,(H,23,25)(H,24,26)(H2,21,27,28) |
| InChIKey | GEMRFHQVHJNLQO-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 131.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |