C31H37N3O — CID 44574358
1,1-bis(4-methylphenyl)-3-(3-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylpropyl)urea (PubChem CID 44574358) has the molecular formula C31H37N3O and a molecular weight of 467.66 g/mol. Its IUPAC name is 1,1-bis(4-methylphenyl)-3-(3-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylpropyl)urea.
| Compound Name | 1,1-bis(4-methylphenyl)-3-(3-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylpropyl)urea |
|---|---|
| PubChem CID | 44574358 |
| Molecular Formula | C31H37N3O |
| Molecular Weight | 467.66 g/mol |
| Exact Mass | 467.29 |
| IUPAC Name | 1,1-bis(4-methylphenyl)-3-(3-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylpropyl)urea |
| SMILES | Cc1ccc(N(C(=O)NCCCN2CCC3(CCc4ccccc43)CC2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C31H37N3O/c1-24-8-12-27(13-9-24)34(28-14-10-25(2)11-15-28)30(35)32-20-5-21-33-22-18-31(19-23-33)17-16-26-6-3-4-7-29(26)31/h3-4,6-15H,5,16-23H2,1-2H3,(H,32,35) |
| InChIKey | KWMMLXRVWDEIDY-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.66 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|