C20H25FN4O4 — CID 44574899
N-[[(5S)-3-[4-[(7Z)-7-ethoxyimino-5-azaspiro[2.4]heptan-5-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 44574899) has the molecular formula C20H25FN4O4 and a molecular weight of 404.44 g/mol. Its IUPAC name is N-[[(5S)-3-[4-[(7Z)-7-ethoxyimino-5-azaspiro[2.4]heptan-5-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[(5S)-3-[4-[(7Z)-7-ethoxyimino-5-azaspiro[2.4]heptan-5-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 44574899 |
| Molecular Formula | C20H25FN4O4 |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | N-[[(5S)-3-[4-[(7Z)-7-ethoxyimino-5-azaspiro[2.4]heptan-5-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CCO/N=C1\CN(c2ccc(N3C[C@H](CNC(C)=O)OC3=O)cc2F)CC12CC2 |
| InChI | InChI=1S/C20H25FN4O4/c1-3-28-23-18-11-24(12-20(18)6-7-20)17-5-4-14(8-16(17)21)25-10-15(29-19(25)27)9-22-13(2)26/h4-5,8,15H,3,6-7,9-12H2,1-2H3,(H,22,26)/b23-18+/t15-/m0/s1 |
| InChIKey | VLFNFDLJHCNSIX-CVIUTVQRSA-N |
| XLogP | 2.28 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|