C30H40O6 — CID 44576123
methyl (1S,2S,6R,7R,8R,10S,12R,13S)-12-acetyloxy-8-benzoyloxy-2,6,13-trimethyltetracyclo[11.2.1.01,10.02,7]hexadecane-6-carboxylate (PubChem CID 44576123) has the molecular formula C30H40O6 and a molecular weight of 496.64 g/mol. Its IUPAC name is methyl (1S,2S,6R,7R,8R,10S,12R,13S)-12-acetyloxy-8-benzoyloxy-2,6,13-trimethyltetracyclo[11.2.1.01,10.02,7]hexadecane-6-carboxylate.
| Compound Name | methyl (1S,2S,6R,7R,8R,10S,12R,13S)-12-acetyloxy-8-benzoyloxy-2,6,13-trimethyltetracyclo[11.2.1.01,10.02,7]hexadecane-6-carboxylate |
|---|---|
| PubChem CID | 44576123 |
| Molecular Formula | C30H40O6 |
| Molecular Weight | 496.64 g/mol |
| Exact Mass | 496.28 |
| IUPAC Name | methyl (1S,2S,6R,7R,8R,10S,12R,13S)-12-acetyloxy-8-benzoyloxy-2,6,13-trimethyltetracyclo[11.2.1.01,10.02,7]hexadecane-6-carboxylate |
| SMILES | COC(=O)[C@]1(C)CCC[C@@]2(C)[C@H]1[C@H](OC(=O)c1ccccc1)C[C@H]1C[C@@H](OC(C)=O)[C@@]3(C)CC[C@]12C3 |
| InChI | InChI=1S/C30H40O6/c1-19(31)35-23-17-21-16-22(36-25(32)20-10-7-6-8-11-20)24-28(3,26(33)34-5)12-9-13-29(24,4)30(21)15-14-27(23,2)18-30/h6-8,10-11,21-24H,9,12-18H2,1-5H3/t21-,22+,23+,24-,27-,28+,29-,30-/m0/s1 |
| InChIKey | RTHGVANMIQDPPO-AUSKNCSFSA-N |
| XLogP | 5.73 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.64 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|