C26H34O4 — CID 58535233
[(1S,2S,6R,7S,8R,10S,13S)-6-(hydroxymethyl)-2,13-dimethyl-12-oxo-8-tetracyclo[11.2.1.01,10.02,7]hexadecanyl] benzoate (PubChem CID 58535233) has the molecular formula C26H34O4 and a molecular weight of 410.55 g/mol. Its IUPAC name is [(1S,2S,6R,7S,8R,10S,13S)-6-(hydroxymethyl)-2,13-dimethyl-12-oxo-8-tetracyclo[11.2.1.01,10.02,7]hexadecanyl] benzoate.
| Compound Name | [(1S,2S,6R,7S,8R,10S,13S)-6-(hydroxymethyl)-2,13-dimethyl-12-oxo-8-tetracyclo[11.2.1.01,10.02,7]hexadecanyl] benzoate |
|---|---|
| PubChem CID | 58535233 |
| Molecular Formula | C26H34O4 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | [(1S,2S,6R,7S,8R,10S,13S)-6-(hydroxymethyl)-2,13-dimethyl-12-oxo-8-tetracyclo[11.2.1.01,10.02,7]hexadecanyl] benzoate |
| SMILES | C[C@]12CC[C@]3(C1)[C@H](CC2=O)C[C@@H](OC(=O)c1ccccc1)[C@H]1[C@H](CO)CCC[C@@]13C |
| InChI | InChI=1S/C26H34O4/c1-24-11-12-26(16-24)19(14-21(24)28)13-20(30-23(29)17-7-4-3-5-8-17)22-18(15-27)9-6-10-25(22,26)2/h3-5,7-8,18-20,22,27H,6,9-16H2,1-2H3/t18-,19-,20+,22+,24-,25-,26-/m0/s1 |
| InChIKey | GWDZFSLRNFJCLZ-XMVLPLKWSA-N |
| XLogP | 4.80 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |