C23H24Cl2N6O — CID 44576685
1-[5-(4-chlorophenyl)-6-(2-chloro-4-pyridinyl)pyrazin-2-yl]-4-(ethylamino)piperidine-4-carboxamide (PubChem CID 44576685) has the molecular formula C23H24Cl2N6O and a molecular weight of 471.39 g/mol. Its IUPAC name is 1-[5-(4-chlorophenyl)-6-(2-chloro-4-pyridinyl)pyrazin-2-yl]-4-(ethylamino)piperidine-4-carboxamide.
| Compound Name | 1-[5-(4-chlorophenyl)-6-(2-chloro-4-pyridinyl)pyrazin-2-yl]-4-(ethylamino)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 44576685 |
| Molecular Formula | C23H24Cl2N6O |
| Molecular Weight | 471.39 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | 1-[5-(4-chlorophenyl)-6-(2-chloro-4-pyridinyl)pyrazin-2-yl]-4-(ethylamino)piperidine-4-carboxamide |
| SMILES | CCNC1(C(N)=O)CCN(c2cnc(-c3ccc(Cl)cc3)c(-c3ccnc(Cl)c3)n2)CC1 |
| InChI | InChI=1S/C23H24Cl2N6O/c1-2-29-23(22(26)32)8-11-31(12-9-23)19-14-28-20(15-3-5-17(24)6-4-15)21(30-19)16-7-10-27-18(25)13-16/h3-7,10,13-14,29H,2,8-9,11-12H2,1H3,(H2,26,32) |
| InChIKey | SQNFNQMIUOAVRI-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 97.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.39 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|