About 6-[(6-chloro-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-ylidene)amino]hexan-1-amine
6-[(6-chloro-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-ylidene)amino]hexan-1-amine (PubChem CID 44577143) has the molecular formula C17H23ClN4
and a molecular weight of 318.85 g/mol. Its IUPAC name is 6-[(6-chloro-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-ylidene)amino]hexan-1-amine.
Molecular Properties
| Compound Name | 6-[(6-chloro-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-ylidene)amino]hexan-1-amine |
| PubChem CID | 44577143 |
| Molecular Formula | C17H23ClN4 |
| Molecular Weight | 318.85 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 6-[(6-chloro-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-ylidene)amino]hexan-1-amine |
| SMILES | NCCCCCC/N=c1/c2ccc(Cl)cc2nc2n1CCC2 |
| InChI | InChI=1S/C17H23ClN4/c18-13-7-8-14-15(12-13)21-16-6-5-11-22(16)17(14)20-10-4-2-1-3-9-19/h7-8,12H,1-6,9-11,19H2/b20-17- |
| InChIKey | HKCWCYUGTZIPER-JZJYNLBNSA-N |
| XLogP | 3.06 |
| TPSA | 56.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.85 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[(6-chloro-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-ylidene)amino]hexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(6-chloro-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-ylidene)amino]hexan-1-amine?
The IUPAC name of 6-[(6-chloro-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-ylidene)amino]hexan-1-amine (CID 44577143) is 6-[(6-chloro-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-ylidene)amino]hexan-1-amine.
What is the SMILES notation for 6-[(6-chloro-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-ylidene)amino]hexan-1-amine?
The canonical SMILES for 6-[(6-chloro-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-ylidene)amino]hexan-1-amine is NCCCCCC/N=c1/c2ccc(Cl)cc2nc2n1CCC2.
What is the InChIKey of 6-[(6-chloro-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-ylidene)amino]hexan-1-amine?
The InChIKey is HKCWCYUGTZIPER-JZJYNLBNSA-N. The full InChI is InChI=1S/C17H23ClN4/c18-13-7-8-14-15(12-13)21-16-6-5-11-22(16)17(14)20-10-4-2-1-3-9-19/h7-8,12H,1-6,9-11,19H2/b20-17-.
What are the key properties of 6-[(6-chloro-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-ylidene)amino]hexan-1-amine?
6-[(6-chloro-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-ylidene)amino]hexan-1-amine has a molecular weight of 318.85 g/mol, XLogP of 3.06, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(6-chloro-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-ylidene)amino]hexan-1-amine is sourced from PubChem (CID 44577143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).