About 8-[(6-chloro-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-ylidene)amino]octan-1-amine
8-[(6-chloro-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-ylidene)amino]octan-1-amine (PubChem CID 44577145) has the molecular formula C19H27ClN4
and a molecular weight of 346.91 g/mol. Its IUPAC name is 8-[(6-chloro-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-ylidene)amino]octan-1-amine.
Molecular Properties
| Compound Name | 8-[(6-chloro-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-ylidene)amino]octan-1-amine |
| PubChem CID | 44577145 |
| Molecular Formula | C19H27ClN4 |
| Molecular Weight | 346.91 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 8-[(6-chloro-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-ylidene)amino]octan-1-amine |
| SMILES | NCCCCCCCC/N=c1/c2ccc(Cl)cc2nc2n1CCC2 |
| InChI | InChI=1S/C19H27ClN4/c20-15-9-10-16-17(14-15)23-18-8-7-13-24(18)19(16)22-12-6-4-2-1-3-5-11-21/h9-10,14H,1-8,11-13,21H2/b22-19- |
| InChIKey | UXJXXAOJZYIMOU-QOCHGBHMSA-N |
| XLogP | 3.84 |
| TPSA | 56.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.91 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-[(6-chloro-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-ylidene)amino]octan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[(6-chloro-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-ylidene)amino]octan-1-amine?
The IUPAC name of 8-[(6-chloro-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-ylidene)amino]octan-1-amine (CID 44577145) is 8-[(6-chloro-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-ylidene)amino]octan-1-amine.
What is the SMILES notation for 8-[(6-chloro-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-ylidene)amino]octan-1-amine?
The canonical SMILES for 8-[(6-chloro-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-ylidene)amino]octan-1-amine is NCCCCCCCC/N=c1/c2ccc(Cl)cc2nc2n1CCC2.
What is the InChIKey of 8-[(6-chloro-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-ylidene)amino]octan-1-amine?
The InChIKey is UXJXXAOJZYIMOU-QOCHGBHMSA-N. The full InChI is InChI=1S/C19H27ClN4/c20-15-9-10-16-17(14-15)23-18-8-7-13-24(18)19(16)22-12-6-4-2-1-3-5-11-21/h9-10,14H,1-8,11-13,21H2/b22-19-.
What are the key properties of 8-[(6-chloro-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-ylidene)amino]octan-1-amine?
8-[(6-chloro-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-ylidene)amino]octan-1-amine has a molecular weight of 346.91 g/mol, XLogP of 3.84, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[(6-chloro-2,3-dihydro-1H-pyrrolo[2,1-b]quinazolin-9-ylidene)amino]octan-1-amine is sourced from PubChem (CID 44577145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).