C25H22F2N2O6 — CID 44577620
4-(4-fluorophenyl)-N-[1-[4-(4-fluorophenyl)-2,4-dioxobutanoyl]piperidin-4-yl]-2,4-dioxobutanamide (PubChem CID 44577620) has the molecular formula C25H22F2N2O6 and a molecular weight of 484.46 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N-[1-[4-(4-fluorophenyl)-2,4-dioxobutanoyl]piperidin-4-yl]-2,4-dioxobutanamide.
| Compound Name | 4-(4-fluorophenyl)-N-[1-[4-(4-fluorophenyl)-2,4-dioxobutanoyl]piperidin-4-yl]-2,4-dioxobutanamide |
|---|---|
| PubChem CID | 44577620 |
| Molecular Formula | C25H22F2N2O6 |
| Molecular Weight | 484.46 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | 4-(4-fluorophenyl)-N-[1-[4-(4-fluorophenyl)-2,4-dioxobutanoyl]piperidin-4-yl]-2,4-dioxobutanamide |
| SMILES | O=C(CC(=O)c1ccc(F)cc1)C(=O)NC1CCN(C(=O)C(=O)CC(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C25H22F2N2O6/c26-17-5-1-15(2-6-17)20(30)13-22(32)24(34)28-19-9-11-29(12-10-19)25(35)23(33)14-21(31)16-3-7-18(27)8-4-16/h1-8,19H,9-14H2,(H,28,34) |
| InChIKey | JHYVDTCOJVVGAT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.46 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|