C24H20F2N2O6 — CID 44577621
4-(4-fluorophenyl)-1-[4-[4-(4-fluorophenyl)-2,4-dioxobutanoyl]piperazin-1-yl]butane-1,2,4-trione (PubChem CID 44577621) has the molecular formula C24H20F2N2O6 and a molecular weight of 470.43 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-1-[4-[4-(4-fluorophenyl)-2,4-dioxobutanoyl]piperazin-1-yl]butane-1,2,4-trione.
| Compound Name | 4-(4-fluorophenyl)-1-[4-[4-(4-fluorophenyl)-2,4-dioxobutanoyl]piperazin-1-yl]butane-1,2,4-trione |
|---|---|
| PubChem CID | 44577621 |
| Molecular Formula | C24H20F2N2O6 |
| Molecular Weight | 470.43 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | 4-(4-fluorophenyl)-1-[4-[4-(4-fluorophenyl)-2,4-dioxobutanoyl]piperazin-1-yl]butane-1,2,4-trione |
| SMILES | O=C(CC(=O)c1ccc(F)cc1)C(=O)N1CCN(C(=O)C(=O)CC(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C24H20F2N2O6/c25-17-5-1-15(2-6-17)19(29)13-21(31)23(33)27-9-11-28(12-10-27)24(34)22(32)14-20(30)16-3-7-18(26)8-4-16/h1-8H,9-14H2 |
| InChIKey | ACCXUGABUJLJTD-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 108.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.43 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|