C20H25FN2O5 — CID 44577622
tert-butyl 4-[[(Z)-4-(4-fluorophenyl)-4-hydroxy-2-oxobut-3-enoyl]amino]piperidine-1-carboxylate (PubChem CID 44577622) has the molecular formula C20H25FN2O5 and a molecular weight of 392.43 g/mol. Its IUPAC name is tert-butyl 4-[[(Z)-4-(4-fluorophenyl)-4-hydroxy-2-oxobut-3-enoyl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[(Z)-4-(4-fluorophenyl)-4-hydroxy-2-oxobut-3-enoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 44577622 |
| Molecular Formula | C20H25FN2O5 |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | tert-butyl 4-[[(Z)-4-(4-fluorophenyl)-4-hydroxy-2-oxobut-3-enoyl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NC(=O)C(=O)/C=C(\O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H25FN2O5/c1-20(2,3)28-19(27)23-10-8-15(9-11-23)22-18(26)17(25)12-16(24)13-4-6-14(21)7-5-13/h4-7,12,15,24H,8-11H2,1-3H3,(H,22,26)/b16-12- |
| InChIKey | DZOYEDCCVXXBFV-VBKFSLOCSA-N |
| XLogP | 2.81 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|