C17H25FN2O5S — CID 174847393
tert-butyl 4-[(4-fluorophenyl)sulfonyloxymethylamino]piperidine-1-carboxylate (PubChem CID 174847393) has the molecular formula C17H25FN2O5S and a molecular weight of 388.46 g/mol. Its IUPAC name is tert-butyl 4-[(4-fluorophenyl)sulfonyloxymethylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(4-fluorophenyl)sulfonyloxymethylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 174847393 |
| Molecular Formula | C17H25FN2O5S |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | tert-butyl 4-[(4-fluorophenyl)sulfonyloxymethylamino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NCOS(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C17H25FN2O5S/c1-17(2,3)25-16(21)20-10-8-14(9-11-20)19-12-24-26(22,23)15-6-4-13(18)5-7-15/h4-7,14,19H,8-12H2,1-3H3 |
| InChIKey | RUXXOIOVPVQWGO-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|