C37H34N2O8 — CID 44578245
2-[(2S,3R,4S)-3-hydroxy-6-(2-methoxyethoxymethoxy)-1-(naphthalene-2-carbonyl)-4-(naphthalene-2-carbonylamino)-3,4-dihydro-2H-quinolin-2-yl]acetic acid (PubChem CID 44578245) has the molecular formula C37H34N2O8 and a molecular weight of 634.69 g/mol. Its IUPAC name is 2-[(2S,3R,4S)-3-hydroxy-6-(2-methoxyethoxymethoxy)-1-(naphthalene-2-carbonyl)-4-(naphthalene-2-carbonylamino)-3,4-dihydro-2H-quinolin-2-yl]acetic acid.
| Compound Name | 2-[(2S,3R,4S)-3-hydroxy-6-(2-methoxyethoxymethoxy)-1-(naphthalene-2-carbonyl)-4-(naphthalene-2-carbonylamino)-3,4-dihydro-2H-quinolin-2-yl]acetic acid |
|---|---|
| PubChem CID | 44578245 |
| Molecular Formula | C37H34N2O8 |
| Molecular Weight | 634.69 g/mol |
| Exact Mass | 634.23 |
| IUPAC Name | 2-[(2S,3R,4S)-3-hydroxy-6-(2-methoxyethoxymethoxy)-1-(naphthalene-2-carbonyl)-4-(naphthalene-2-carbonylamino)-3,4-dihydro-2H-quinolin-2-yl]acetic acid |
| SMILES | COCCOCOc1ccc2c(c1)[C@H](NC(=O)c1ccc3ccccc3c1)[C@@H](O)[C@H](CC(=O)O)N2C(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C37H34N2O8/c1-45-16-17-46-22-47-29-14-15-31-30(20-29)34(38-36(43)27-12-10-23-6-2-4-8-25(23)18-27)35(42)32(21-33(40)41)39(31)37(44)28-13-11-24-7-3-5-9-26(24)19-28/h2-15,18-20,32,34-35,42H,16-17,21-22H2,1H3,(H,38,43)(H,40,41)/t32-,34-,35-/m0/s1 |
| InChIKey | XOSXYBCDOASWII-SYRLMZQMSA-N |
| XLogP | 5.33 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.69 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|