C28H30N2O7 — CID 6709834
[(2S,3S)-5-(2-methoxyethoxymethoxy)-3-(phenylmethoxycarbonylamino)-2,3-dihydro-1H-indol-2-yl]methyl benzoate (PubChem CID 6709834) has the molecular formula C28H30N2O7 and a molecular weight of 506.56 g/mol. Its IUPAC name is [(2S,3S)-5-(2-methoxyethoxymethoxy)-3-(phenylmethoxycarbonylamino)-2,3-dihydro-1H-indol-2-yl]methyl benzoate.
| Compound Name | [(2S,3S)-5-(2-methoxyethoxymethoxy)-3-(phenylmethoxycarbonylamino)-2,3-dihydro-1H-indol-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 6709834 |
| Molecular Formula | C28H30N2O7 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | [(2S,3S)-5-(2-methoxyethoxymethoxy)-3-(phenylmethoxycarbonylamino)-2,3-dihydro-1H-indol-2-yl]methyl benzoate |
| SMILES | COCCOCOc1ccc2c(c1)[C@H](NC(=O)OCc1ccccc1)[C@@H](COC(=O)c1ccccc1)N2 |
| InChI | InChI=1S/C28H30N2O7/c1-33-14-15-34-19-37-22-12-13-24-23(16-22)26(30-28(32)36-17-20-8-4-2-5-9-20)25(29-24)18-35-27(31)21-10-6-3-7-11-21/h2-13,16,25-26,29H,14-15,17-19H2,1H3,(H,30,32)/t25-,26+/m1/s1 |
| InChIKey | QHWLQWZHUOHKQG-FTJBHMTQSA-N |
| XLogP | 4.30 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|