C31H34N2O7 — CID 6710039
prop-2-enyl N-[(3R,4S)-6-(2-methoxyethoxymethoxy)-2,3-bis(phenylmethoxy)-3,4-dihydroquinolin-4-yl]carbamate (PubChem CID 6710039) has the molecular formula C31H34N2O7 and a molecular weight of 546.62 g/mol. Its IUPAC name is prop-2-enyl N-[(3R,4S)-6-(2-methoxyethoxymethoxy)-2,3-bis(phenylmethoxy)-3,4-dihydroquinolin-4-yl]carbamate.
| Compound Name | prop-2-enyl N-[(3R,4S)-6-(2-methoxyethoxymethoxy)-2,3-bis(phenylmethoxy)-3,4-dihydroquinolin-4-yl]carbamate |
|---|---|
| PubChem CID | 6710039 |
| Molecular Formula | C31H34N2O7 |
| Molecular Weight | 546.62 g/mol |
| Exact Mass | 546.24 |
| IUPAC Name | prop-2-enyl N-[(3R,4S)-6-(2-methoxyethoxymethoxy)-2,3-bis(phenylmethoxy)-3,4-dihydroquinolin-4-yl]carbamate |
| SMILES | C=CCOC(=O)N[C@H]1c2cc(OCOCCOC)ccc2N=C(OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C31H34N2O7/c1-3-16-37-31(34)33-28-26-19-25(40-22-36-18-17-35-2)14-15-27(26)32-30(39-21-24-12-8-5-9-13-24)29(28)38-20-23-10-6-4-7-11-23/h3-15,19,28-29H,1,16-18,20-22H2,2H3,(H,33,34)/t28-,29+/m0/s1 |
| InChIKey | NCKXWVXIDZPCJM-URLMMPGGSA-N |
| XLogP | 5.49 |
| TPSA | 96.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.62 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|