C17H23NO4 — CID 44578881
6-[3-(diethylamino)-2-hydroxypropoxy]-4-methylchromen-2-one (PubChem CID 44578881) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is 6-[3-(diethylamino)-2-hydroxypropoxy]-4-methylchromen-2-one.
| Compound Name | 6-[3-(diethylamino)-2-hydroxypropoxy]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 44578881 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 6-[3-(diethylamino)-2-hydroxypropoxy]-4-methylchromen-2-one |
| SMILES | CCN(CC)CC(O)COc1ccc2oc(=O)cc(C)c2c1 |
| InChI | InChI=1S/C17H23NO4/c1-4-18(5-2)10-13(19)11-21-14-6-7-16-15(9-14)12(3)8-17(20)22-16/h6-9,13,19H,4-5,10-11H2,1-3H3 |
| InChIKey | XISVELZPBQONBR-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|