C19H17ClF3N3 — CID 44579137
(1-benzyl-3,4-dihydro-2H-pyridin-5-yl)-[4-chloro-3-(trifluoromethyl)phenyl]diazene (PubChem CID 44579137) has the molecular formula C19H17ClF3N3 and a molecular weight of 379.81 g/mol. Its IUPAC name is (1-benzyl-3,4-dihydro-2H-pyridin-5-yl)-[4-chloro-3-(trifluoromethyl)phenyl]diazene.
| Compound Name | (1-benzyl-3,4-dihydro-2H-pyridin-5-yl)-[4-chloro-3-(trifluoromethyl)phenyl]diazene |
|---|---|
| PubChem CID | 44579137 |
| Molecular Formula | C19H17ClF3N3 |
| Molecular Weight | 379.81 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | (1-benzyl-3,4-dihydro-2H-pyridin-5-yl)-[4-chloro-3-(trifluoromethyl)phenyl]diazene |
| SMILES | FC(F)(F)c1cc(/N=N/C2=CN(Cc3ccccc3)CCC2)ccc1Cl |
| InChI | InChI=1S/C19H17ClF3N3/c20-18-9-8-15(11-17(18)19(21,22)23)24-25-16-7-4-10-26(13-16)12-14-5-2-1-3-6-14/h1-3,5-6,8-9,11,13H,4,7,10,12H2/b25-24+ |
| InChIKey | IONSCDXOGZLRJW-OCOZRVBESA-N |
| XLogP | 6.58 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.81 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|