C21H20ClNO7 — CID 44579692
2-chloro-N-[6-methoxy-2-(3,4,5-trimethoxybenzoyl)-1-benzofuran-3-yl]acetamide (PubChem CID 44579692) has the molecular formula C21H20ClNO7 and a molecular weight of 433.84 g/mol. Its IUPAC name is 2-chloro-N-[6-methoxy-2-(3,4,5-trimethoxybenzoyl)-1-benzofuran-3-yl]acetamide.
| Compound Name | 2-chloro-N-[6-methoxy-2-(3,4,5-trimethoxybenzoyl)-1-benzofuran-3-yl]acetamide |
|---|---|
| PubChem CID | 44579692 |
| Molecular Formula | C21H20ClNO7 |
| Molecular Weight | 433.84 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | 2-chloro-N-[6-methoxy-2-(3,4,5-trimethoxybenzoyl)-1-benzofuran-3-yl]acetamide |
| SMILES | COc1ccc2c(NC(=O)CCl)c(C(=O)c3cc(OC)c(OC)c(OC)c3)oc2c1 |
| InChI | InChI=1S/C21H20ClNO7/c1-26-12-5-6-13-14(9-12)30-21(18(13)23-17(24)10-22)19(25)11-7-15(27-2)20(29-4)16(8-11)28-3/h5-9H,10H2,1-4H3,(H,23,24) |
| InChIKey | GFTHEPQQGPJZRQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.84 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|