C26H24O8 — CID 23549558
[3-(2,3-dihydroxy-4-methoxyphenyl)-6-methoxy-1-benzofuran-2-yl]-(3,4-dimethoxy-5-methylphenyl)methanone (PubChem CID 23549558) has the molecular formula C26H24O8 and a molecular weight of 464.47 g/mol. Its IUPAC name is [3-(2,3-dihydroxy-4-methoxyphenyl)-6-methoxy-1-benzofuran-2-yl]-(3,4-dimethoxy-5-methylphenyl)methanone.
| Compound Name | [3-(2,3-dihydroxy-4-methoxyphenyl)-6-methoxy-1-benzofuran-2-yl]-(3,4-dimethoxy-5-methylphenyl)methanone |
|---|---|
| PubChem CID | 23549558 |
| Molecular Formula | C26H24O8 |
| Molecular Weight | 464.47 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | [3-(2,3-dihydroxy-4-methoxyphenyl)-6-methoxy-1-benzofuran-2-yl]-(3,4-dimethoxy-5-methylphenyl)methanone |
| SMILES | COc1ccc2c(-c3ccc(OC)c(O)c3O)c(C(=O)c3cc(C)c(OC)c(OC)c3)oc2c1 |
| InChI | InChI=1S/C26H24O8/c1-13-10-14(11-20(32-4)25(13)33-5)22(27)26-21(16-7-6-15(30-2)12-19(16)34-26)17-8-9-18(31-3)24(29)23(17)28/h6-12,28-29H,1-5H3 |
| InChIKey | OEVJZROEEMKFQE-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 107.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.47 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|