C17H26N2O3S2 — CID 44581453
(2S)-4-[[4-(dimethylamino)phenyl]methylsulfanyl]-2-[[(2S)-2-methyl-3-sulfanylpropanoyl]amino]butanoic acid (PubChem CID 44581453) has the molecular formula C17H26N2O3S2 and a molecular weight of 370.54 g/mol. Its IUPAC name is (2S)-4-[[4-(dimethylamino)phenyl]methylsulfanyl]-2-[[(2S)-2-methyl-3-sulfanylpropanoyl]amino]butanoic acid.
| Compound Name | (2S)-4-[[4-(dimethylamino)phenyl]methylsulfanyl]-2-[[(2S)-2-methyl-3-sulfanylpropanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 44581453 |
| Molecular Formula | C17H26N2O3S2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | (2S)-4-[[4-(dimethylamino)phenyl]methylsulfanyl]-2-[[(2S)-2-methyl-3-sulfanylpropanoyl]amino]butanoic acid |
| SMILES | C[C@H](CS)C(=O)N[C@@H](CCSCc1ccc(N(C)C)cc1)C(=O)O |
| InChI | InChI=1S/C17H26N2O3S2/c1-12(10-23)16(20)18-15(17(21)22)8-9-24-11-13-4-6-14(7-5-13)19(2)3/h4-7,12,15,23H,8-11H2,1-3H3,(H,18,20)(H,21,22)/t12-,15+/m1/s1 |
| InChIKey | OHBQNNCIMPPZGY-DOMZBBRYSA-N |
| XLogP | 2.51 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|