C24H42N2 — CID 44582979
2-[(E)-heptadec-8-enyl]-4,5,6,7-tetrahydro-1H-benzimidazole (PubChem CID 44582979) has the molecular formula C24H42N2 and a molecular weight of 358.61 g/mol. Its IUPAC name is 2-[(E)-heptadec-8-enyl]-4,5,6,7-tetrahydro-1H-benzimidazole.
| Compound Name | 2-[(E)-heptadec-8-enyl]-4,5,6,7-tetrahydro-1H-benzimidazole |
|---|---|
| PubChem CID | 44582979 |
| Molecular Formula | C24H42N2 |
| Molecular Weight | 358.61 g/mol |
| Exact Mass | 358.33 |
| IUPAC Name | 2-[(E)-heptadec-8-enyl]-4,5,6,7-tetrahydro-1H-benzimidazole |
| SMILES | CCCCCCCC/C=C/CCCCCCCc1nc2c([nH]1)CCCC2 |
| InChI | InChI=1S/C24H42N2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-21-24-25-22-19-17-18-20-23(22)26-24/h9-10H,2-8,11-21H2,1H3,(H,25,26)/b10-9+ |
| InChIKey | FBLIVAXTFYWHLZ-MDZDMXLPSA-N |
| XLogP | 7.48 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.61 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|