C17H23NO3S2 — CID 44586760
(2S,5S)-1-[(2S)-2-methyl-3-sulfanylpropanoyl]-5-(2-phenylethylsulfanyl)pyrrolidine-2-carboxylic acid (PubChem CID 44586760) has the molecular formula C17H23NO3S2 and a molecular weight of 353.51 g/mol. Its IUPAC name is (2S,5S)-1-[(2S)-2-methyl-3-sulfanylpropanoyl]-5-(2-phenylethylsulfanyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,5S)-1-[(2S)-2-methyl-3-sulfanylpropanoyl]-5-(2-phenylethylsulfanyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 44586760 |
| Molecular Formula | C17H23NO3S2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | (2S,5S)-1-[(2S)-2-methyl-3-sulfanylpropanoyl]-5-(2-phenylethylsulfanyl)pyrrolidine-2-carboxylic acid |
| SMILES | C[C@H](CS)C(=O)N1[C@@H](SCCc2ccccc2)CC[C@H]1C(=O)O |
| InChI | InChI=1S/C17H23NO3S2/c1-12(11-22)16(19)18-14(17(20)21)7-8-15(18)23-10-9-13-5-3-2-4-6-13/h2-6,12,14-15,22H,7-11H2,1H3,(H,20,21)/t12-,14+,15+/m1/s1 |
| InChIKey | QVHZTNDYZCMLFE-SNPRPXQTSA-N |
| XLogP | 2.93 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|