C19H26NO5PS2 — CID 13136852
(8S)-7-[2-[hydroxy(4-phenylbutyl)phosphoryl]acetyl]-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid (PubChem CID 13136852) has the molecular formula C19H26NO5PS2 and a molecular weight of 443.53 g/mol. Its IUPAC name is (8S)-7-[2-[hydroxy(4-phenylbutyl)phosphoryl]acetyl]-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid.
| Compound Name | (8S)-7-[2-[hydroxy(4-phenylbutyl)phosphoryl]acetyl]-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid |
|---|---|
| PubChem CID | 13136852 |
| Molecular Formula | C19H26NO5PS2 |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | (8S)-7-[2-[hydroxy(4-phenylbutyl)phosphoryl]acetyl]-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CC2(CN1C(=O)CP(=O)(O)CCCCc1ccccc1)SCCS2 |
| InChI | InChI=1S/C19H26NO5PS2/c21-17(20-14-19(27-10-11-28-19)12-16(20)18(22)23)13-26(24,25)9-5-4-8-15-6-2-1-3-7-15/h1-3,6-7,16H,4-5,8-14H2,(H,22,23)(H,24,25)/t16-/m0/s1 |
| InChIKey | SCLVAMUVMTZGEU-INIZCTEOSA-N |
| XLogP | 3.14 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|