C19H25LiNO5PS2 — CID 70686892
lithium (8S)-7-[2-[hydroxy(4-phenylbutyl)phosphoryl]acetyl]-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylate (PubChem CID 70686892) has the molecular formula C19H25LiNO5PS2 and a molecular weight of 449.46 g/mol. Its IUPAC name is lithium (8S)-7-[2-[hydroxy(4-phenylbutyl)phosphoryl]acetyl]-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylate.
| Compound Name | lithium (8S)-7-[2-[hydroxy(4-phenylbutyl)phosphoryl]acetyl]-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylate |
|---|---|
| PubChem CID | 70686892 |
| Molecular Formula | C19H25LiNO5PS2 |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | lithium (8S)-7-[2-[hydroxy(4-phenylbutyl)phosphoryl]acetyl]-1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylate |
| SMILES | O=C([O-])[C@@H]1CC2(CN1C(=O)CP(=O)(O)CCCCc1ccccc1)SCCS2.[Li+] |
| InChI | InChI=1S/C19H26NO5PS2.Li/c21-17(20-14-19(27-10-11-28-19)12-16(20)18(22)23)13-26(24,25)9-5-4-8-15-6-2-1-3-7-15;/h1-3,6-7,16H,4-5,8-14H2,(H,22,23)(H,24,25);/q;+1/p-1/t16-;/m0./s1 |
| InChIKey | DFXNPQVIKXXANO-NTISSMGPSA-M |
| XLogP | -1.19 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|