C17H24NO5P — CID 12962091
(2S)-1-[2-[hydroxy(4-phenylbutyl)phosphoryl]acetyl]pyrrolidine-2-carboxylic acid (PubChem CID 12962091) has the molecular formula C17H24NO5P and a molecular weight of 353.36 g/mol. Its IUPAC name is (2S)-1-[2-[hydroxy(4-phenylbutyl)phosphoryl]acetyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[2-[hydroxy(4-phenylbutyl)phosphoryl]acetyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 12962091 |
| Molecular Formula | C17H24NO5P |
| Molecular Weight | 353.36 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | (2S)-1-[2-[hydroxy(4-phenylbutyl)phosphoryl]acetyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN1C(=O)CP(=O)(O)CCCCc1ccccc1 |
| InChI | InChI=1S/C17H24NO5P/c19-16(18-11-6-10-15(18)17(20)21)13-24(22,23)12-5-4-9-14-7-2-1-3-8-14/h1-3,7-8,15H,4-6,9-13H2,(H,20,21)(H,22,23)/t15-/m0/s1 |
| InChIKey | OVVFJXPYMIMYNK-HNNXBMFYSA-N |
| XLogP | 2.36 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|