C29H30N2O2 — CID 44589102
ethyl 4-[4-(2-ethyl-4,5-diphenylimidazol-1-yl)phenyl]butanoate (PubChem CID 44589102) has the molecular formula C29H30N2O2 and a molecular weight of 438.57 g/mol. Its IUPAC name is ethyl 4-[4-(2-ethyl-4,5-diphenylimidazol-1-yl)phenyl]butanoate.
| Compound Name | ethyl 4-[4-(2-ethyl-4,5-diphenylimidazol-1-yl)phenyl]butanoate |
|---|---|
| PubChem CID | 44589102 |
| Molecular Formula | C29H30N2O2 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | ethyl 4-[4-(2-ethyl-4,5-diphenylimidazol-1-yl)phenyl]butanoate |
| SMILES | CCOC(=O)CCCc1ccc(-n2c(CC)nc(-c3ccccc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H30N2O2/c1-3-26-30-28(23-13-7-5-8-14-23)29(24-15-9-6-10-16-24)31(26)25-20-18-22(19-21-25)12-11-17-27(32)33-4-2/h5-10,13-16,18-21H,3-4,11-12,17H2,1-2H3 |
| InChIKey | UCOLADYLQKIIGE-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |