C19H28N2O3 — CID 44589150
(1S,2R,5R)-8-[(2,4-dimethoxyphenyl)methyl]-6-prop-2-enyl-6,8-diazabicyclo[3.2.2]nonan-2-ol (PubChem CID 44589150) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is (1S,2R,5R)-8-[(2,4-dimethoxyphenyl)methyl]-6-prop-2-enyl-6,8-diazabicyclo[3.2.2]nonan-2-ol.
| Compound Name | (1S,2R,5R)-8-[(2,4-dimethoxyphenyl)methyl]-6-prop-2-enyl-6,8-diazabicyclo[3.2.2]nonan-2-ol |
|---|---|
| PubChem CID | 44589150 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | (1S,2R,5R)-8-[(2,4-dimethoxyphenyl)methyl]-6-prop-2-enyl-6,8-diazabicyclo[3.2.2]nonan-2-ol |
| SMILES | C=CCN1C[C@H]2[C@H](O)CC[C@@H]1CN2Cc1ccc(OC)cc1OC |
| InChI | InChI=1S/C19H28N2O3/c1-4-9-20-13-17-18(22)8-6-15(20)12-21(17)11-14-5-7-16(23-2)10-19(14)24-3/h4-5,7,10,15,17-18,22H,1,6,8-9,11-13H2,2-3H3/t15-,17+,18-/m1/s1 |
| InChIKey | PPOMIEBKBJAFCD-BPQIPLTHSA-N |
| XLogP | 1.90 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|