C20H28N2O2 — CID 143368421
1-[(2,4-dimethoxyphenyl)methyl]-4-[(2E)-2-ethenylpenta-2,4-dienyl]piperazine (PubChem CID 143368421) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 1-[(2,4-dimethoxyphenyl)methyl]-4-[(2E)-2-ethenylpenta-2,4-dienyl]piperazine.
| Compound Name | 1-[(2,4-dimethoxyphenyl)methyl]-4-[(2E)-2-ethenylpenta-2,4-dienyl]piperazine |
|---|---|
| PubChem CID | 143368421 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | 1-[(2,4-dimethoxyphenyl)methyl]-4-[(2E)-2-ethenylpenta-2,4-dienyl]piperazine |
| SMILES | C=C/C=C(\C=C)CN1CCN(Cc2ccc(OC)cc2OC)CC1 |
| InChI | InChI=1S/C20H28N2O2/c1-5-7-17(6-2)15-21-10-12-22(13-11-21)16-18-8-9-19(23-3)14-20(18)24-4/h5-9,14H,1-2,10-13,15-16H2,3-4H3/b17-7+ |
| InChIKey | WXSZLZFVKJLKCB-REZTVBANSA-N |
| XLogP | 3.12 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|