C25H29ClFN3O4S — CID 44590184
(3R)-3-amino-4-(5-chloro-2-fluorophenyl)-N-[4-[6-(2-methoxyethoxy)-1,3-benzothiazol-2-yl]oxan-4-yl]butanamide (PubChem CID 44590184) has the molecular formula C25H29ClFN3O4S and a molecular weight of 522.04 g/mol. Its IUPAC name is (3R)-3-amino-4-(5-chloro-2-fluorophenyl)-N-[4-[6-(2-methoxyethoxy)-1,3-benzothiazol-2-yl]oxan-4-yl]butanamide.
| Compound Name | (3R)-3-amino-4-(5-chloro-2-fluorophenyl)-N-[4-[6-(2-methoxyethoxy)-1,3-benzothiazol-2-yl]oxan-4-yl]butanamide |
|---|---|
| PubChem CID | 44590184 |
| Molecular Formula | C25H29ClFN3O4S |
| Molecular Weight | 522.04 g/mol |
| Exact Mass | 521.16 |
| IUPAC Name | (3R)-3-amino-4-(5-chloro-2-fluorophenyl)-N-[4-[6-(2-methoxyethoxy)-1,3-benzothiazol-2-yl]oxan-4-yl]butanamide |
| SMILES | COCCOc1ccc2nc(C3(NC(=O)C[C@H](N)Cc4cc(Cl)ccc4F)CCOCC3)sc2c1 |
| InChI | InChI=1S/C25H29ClFN3O4S/c1-32-10-11-34-19-3-5-21-22(15-19)35-24(29-21)25(6-8-33-9-7-25)30-23(31)14-18(28)13-16-12-17(26)2-4-20(16)27/h2-5,12,15,18H,6-11,13-14,28H2,1H3,(H,30,31)/t18-/m1/s1 |
| InChIKey | NXGVIDAYNDDLLI-GOSISDBHSA-N |
| XLogP | 4.20 |
| TPSA | 95.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.04 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|