C20H23FO2 — CID 44590996
(1E,4E)-1-(2-fluorophenyl)-5-(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)penta-1,4-dien-3-one (PubChem CID 44590996) has the molecular formula C20H23FO2 and a molecular weight of 314.40 g/mol. Its IUPAC name is (1E,4E)-1-(2-fluorophenyl)-5-(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1-(2-fluorophenyl)-5-(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 44590996 |
| Molecular Formula | C20H23FO2 |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | (1E,4E)-1-(2-fluorophenyl)-5-(3-hydroxy-2,6,6-trimethylcyclohexen-1-yl)penta-1,4-dien-3-one |
| SMILES | CC1=C(/C=C/C(=O)/C=C/c2ccccc2F)C(C)(C)CCC1O |
| InChI | InChI=1S/C20H23FO2/c1-14-17(20(2,3)13-12-19(14)23)11-10-16(22)9-8-15-6-4-5-7-18(15)21/h4-11,19,23H,12-13H2,1-3H3/b9-8+,11-10+ |
| InChIKey | IUDQMHLEYLGKDK-BNFZFUHLSA-N |
| XLogP | 4.46 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|