C22H18N4 — CID 44594093
3-(2-benzylphenyl)-6-(3-methylphenyl)-1,2,4,5-tetrazine (PubChem CID 44594093) has the molecular formula C22H18N4 and a molecular weight of 338.41 g/mol. Its IUPAC name is 3-(2-benzylphenyl)-6-(3-methylphenyl)-1,2,4,5-tetrazine.
| Compound Name | 3-(2-benzylphenyl)-6-(3-methylphenyl)-1,2,4,5-tetrazine |
|---|---|
| PubChem CID | 44594093 |
| Molecular Formula | C22H18N4 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 3-(2-benzylphenyl)-6-(3-methylphenyl)-1,2,4,5-tetrazine |
| SMILES | Cc1cccc(-c2nnc(-c3ccccc3Cc3ccccc3)nn2)c1 |
| InChI | InChI=1S/C22H18N4/c1-16-8-7-12-19(14-16)21-23-25-22(26-24-21)20-13-6-5-11-18(20)15-17-9-3-2-4-10-17/h2-14H,15H2,1H3 |
| InChIKey | POILAYLBHJUQIP-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |