C17H16N2S — CID 82106454
5-benzyl-4-(3-methylphenyl)-1,3-thiazol-2-amine (PubChem CID 82106454) has the molecular formula C17H16N2S and a molecular weight of 280.40 g/mol. Its IUPAC name is 5-benzyl-4-(3-methylphenyl)-1,3-thiazol-2-amine.
| Compound Name | 5-benzyl-4-(3-methylphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 82106454 |
| Molecular Formula | C17H16N2S |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 5-benzyl-4-(3-methylphenyl)-1,3-thiazol-2-amine |
| SMILES | Cc1cccc(-c2nc(N)sc2Cc2ccccc2)c1 |
| InChI | InChI=1S/C17H16N2S/c1-12-6-5-9-14(10-12)16-15(20-17(18)19-16)11-13-7-3-2-4-8-13/h2-10H,11H2,1H3,(H2,18,19) |
| InChIKey | WVIAWCMTDVFJRU-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |