About 5-pentyl-4-phenyl-1,3-thiazol-2-amine
5-pentyl-4-phenyl-1,3-thiazol-2-amine (PubChem CID 3356434) has the molecular formula C14H18N2S
and a molecular weight of 246.38 g/mol. Its IUPAC name is 5-pentyl-4-phenyl-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 5-pentyl-4-phenyl-1,3-thiazol-2-amine |
| PubChem CID | 3356434 |
| Molecular Formula | C14H18N2S |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 5-pentyl-4-phenyl-1,3-thiazol-2-amine |
| SMILES | CCCCCc1sc(N)nc1-c1ccccc1 |
| InChI | InChI=1S/C14H18N2S/c1-2-3-5-10-12-13(16-14(15)17-12)11-8-6-4-7-9-11/h4,6-9H,2-3,5,10H2,1H3,(H2,15,16) |
| InChIKey | JLEPGFXBHGPAFV-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-pentyl-4-phenyl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-pentyl-4-phenyl-1,3-thiazol-2-amine?
The IUPAC name of 5-pentyl-4-phenyl-1,3-thiazol-2-amine (CID 3356434) is 5-pentyl-4-phenyl-1,3-thiazol-2-amine.
What is the SMILES notation for 5-pentyl-4-phenyl-1,3-thiazol-2-amine?
The canonical SMILES for 5-pentyl-4-phenyl-1,3-thiazol-2-amine is CCCCCc1sc(N)nc1-c1ccccc1.
What is the InChIKey of 5-pentyl-4-phenyl-1,3-thiazol-2-amine?
The InChIKey is JLEPGFXBHGPAFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2S/c1-2-3-5-10-12-13(16-14(15)17-12)11-8-6-4-7-9-11/h4,6-9H,2-3,5,10H2,1H3,(H2,15,16).
What are the key properties of 5-pentyl-4-phenyl-1,3-thiazol-2-amine?
5-pentyl-4-phenyl-1,3-thiazol-2-amine has a molecular weight of 246.38 g/mol, XLogP of 4.12, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pentyl-4-phenyl-1,3-thiazol-2-amine is sourced from PubChem (CID 3356434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).