C17H16N2S — CID 88924616
4-phenyl-5-(2-phenylethyl)-1,3-thiazol-2-amine (PubChem CID 88924616) has the molecular formula C17H16N2S and a molecular weight of 280.40 g/mol. Its IUPAC name is 4-phenyl-5-(2-phenylethyl)-1,3-thiazol-2-amine.
| Compound Name | 4-phenyl-5-(2-phenylethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 88924616 |
| Molecular Formula | C17H16N2S |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 4-phenyl-5-(2-phenylethyl)-1,3-thiazol-2-amine |
| SMILES | Nc1nc(-c2ccccc2)c(CCc2ccccc2)s1 |
| InChI | InChI=1S/C17H16N2S/c18-17-19-16(14-9-5-2-6-10-14)15(20-17)12-11-13-7-3-1-4-8-13/h1-10H,11-12H2,(H2,18,19) |
| InChIKey | WUJMSYVUUQROPB-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |