C15H27N5O2 — CID 44596861
4-amino-5-(1-hydroxyethyl)-6-methyl-2-[3-(4-methylpiperazin-1-yl)propyl]pyridazin-3-one (PubChem CID 44596861) has the molecular formula C15H27N5O2 and a molecular weight of 309.41 g/mol. Its IUPAC name is 4-amino-5-(1-hydroxyethyl)-6-methyl-2-[3-(4-methylpiperazin-1-yl)propyl]pyridazin-3-one.
| Compound Name | 4-amino-5-(1-hydroxyethyl)-6-methyl-2-[3-(4-methylpiperazin-1-yl)propyl]pyridazin-3-one |
|---|---|
| PubChem CID | 44596861 |
| Molecular Formula | C15H27N5O2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.22 |
| IUPAC Name | 4-amino-5-(1-hydroxyethyl)-6-methyl-2-[3-(4-methylpiperazin-1-yl)propyl]pyridazin-3-one |
| SMILES | Cc1nn(CCCN2CCN(C)CC2)c(=O)c(N)c1C(C)O |
| InChI | InChI=1S/C15H27N5O2/c1-11-13(12(2)21)14(16)15(22)20(17-11)6-4-5-19-9-7-18(3)8-10-19/h12,21H,4-10,16H2,1-3H3 |
| InChIKey | DISZAVKXIPJCDW-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |