C19H36O6Si — CID 44598839
(2R,3R,4aS,5R,8S,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethoxy-2,3,6-trimethyl-4a,5,8,8a-tetrahydro-1,4-benzodioxin-5-ol (PubChem CID 44598839) has the molecular formula C19H36O6Si and a molecular weight of 388.58 g/mol. Its IUPAC name is (2R,3R,4aS,5R,8S,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethoxy-2,3,6-trimethyl-4a,5,8,8a-tetrahydro-1,4-benzodioxin-5-ol.
| Compound Name | (2R,3R,4aS,5R,8S,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethoxy-2,3,6-trimethyl-4a,5,8,8a-tetrahydro-1,4-benzodioxin-5-ol |
|---|---|
| PubChem CID | 44598839 |
| Molecular Formula | C19H36O6Si |
| Molecular Weight | 388.58 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | (2R,3R,4aS,5R,8S,8aR)-8-[tert-butyl(dimethyl)silyl]oxy-2,3-dimethoxy-2,3,6-trimethyl-4a,5,8,8a-tetrahydro-1,4-benzodioxin-5-ol |
| SMILES | CO[C@]1(C)O[C@@H]2[C@@H](O[C@@]1(C)OC)[C@H](O)C(C)=C[C@@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H36O6Si/c1-12-11-13(25-26(9,10)17(2,3)4)15-16(14(12)20)24-19(6,22-8)18(5,21-7)23-15/h11,13-16,20H,1-10H3/t13-,14+,15-,16-,18+,19+/m0/s1 |
| InChIKey | RSGZJUIKEBSXSY-HDVFIIHRSA-N |
| XLogP | 3.21 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.58 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|