C44H50N5O2S+ — CID 44599054
N-[3-[(2-cyano-1,3-benzothiazol-6-yl)oxy]propyl]-6-[2-[(1E,3E,5Z)-5-(1-ethyl-3,3-dimethylindol-2-ylidene)penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]hexanamide (PubChem CID 44599054) has the molecular formula C44H50N5O2S+ and a molecular weight of 712.98 g/mol. Its IUPAC name is N-[3-[(2-cyano-1,3-benzothiazol-6-yl)oxy]propyl]-6-[2-[(1E,3E,5Z)-5-(1-ethyl-3,3-dimethylindol-2-ylidene)penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]hexanamide.
| Compound Name | N-[3-[(2-cyano-1,3-benzothiazol-6-yl)oxy]propyl]-6-[2-[(1E,3E,5Z)-5-(1-ethyl-3,3-dimethylindol-2-ylidene)penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]hexanamide |
|---|---|
| PubChem CID | 44599054 |
| Molecular Formula | C44H50N5O2S+ |
| Molecular Weight | 712.98 g/mol |
| Exact Mass | 712.37 |
| IUPAC Name | N-[3-[(2-cyano-1,3-benzothiazol-6-yl)oxy]propyl]-6-[2-[(1E,3E,5Z)-5-(1-ethyl-3,3-dimethylindol-2-ylidene)penta-1,3-dienyl]-3,3-dimethylindol-1-ium-1-yl]hexanamide |
| SMILES | CCN1/C(=C\C=C\C=C\C2=[N+](CCCCCC(=O)NCCCOc3ccc4nc(C#N)sc4c3)c3ccccc3C2(C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C44H49N5O2S/c1-6-48-36-20-14-12-18-33(36)43(2,3)39(48)22-9-7-10-23-40-44(4,5)34-19-13-15-21-37(34)49(40)28-16-8-11-24-41(50)46-27-17-29-51-32-25-26-35-38(30-32)52-42(31-45)47-35/h7,9-10,12-15,18-23,25-26,30H,6,8,11,16-17,24,27-29H2,1-5H3/p+1 |
| InChIKey | IJYHTLAYAIRRGO-UHFFFAOYSA-O |
| XLogP | 9.50 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.98 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|