C17H14FNO2 — CID 44603553
(2S)-2-[(R)-(3-fluoroanilino)-phenylmethyl]-2H-furan-5-one (PubChem CID 44603553) has the molecular formula C17H14FNO2 and a molecular weight of 283.30 g/mol. Its IUPAC name is (2S)-2-[(R)-(3-fluoroanilino)-phenylmethyl]-2H-furan-5-one.
| Compound Name | (2S)-2-[(R)-(3-fluoroanilino)-phenylmethyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 44603553 |
| Molecular Formula | C17H14FNO2 |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | (2S)-2-[(R)-(3-fluoroanilino)-phenylmethyl]-2H-furan-5-one |
| SMILES | O=C1C=C[C@@H]([C@H](Nc2cccc(F)c2)c2ccccc2)O1 |
| InChI | InChI=1S/C17H14FNO2/c18-13-7-4-8-14(11-13)19-17(12-5-2-1-3-6-12)15-9-10-16(20)21-15/h1-11,15,17,19H/t15-,17+/m0/s1 |
| InChIKey | KICARVXKLBQXEW-DOTOQJQBSA-N |
| XLogP | 3.46 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |